C18H24O2 — CID 139609243
(3aS,3bR,9aR,9bS,11aS)-9a,11a-dimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-1-one (PubChem CID 139609243) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bS,11aS)-9a,11a-dimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-1-one.
| Compound Name | (3aS,3bR,9aR,9bS,11aS)-9a,11a-dimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-1-one |
|---|---|
| PubChem CID | 139609243 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (3aS,3bR,9aR,9bS,11aS)-9a,11a-dimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-1-one |
| SMILES | C[C@]12CCC=CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C18H24O2/c1-17-9-4-3-5-12(17)6-7-13-14(17)8-10-18(2)15(13)11-20-16(18)19/h3,5-6,13-15H,4,7-11H2,1-2H3/t13-,14+,15+,17+,18+/m1/s1 |
| InChIKey | KFBJYJGWDLMWTP-RCMKLKEOSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |