About pyrene-1,8-dicarbohydrazide
pyrene-1,8-dicarbohydrazide (PubChem CID 139611940) has the molecular formula C18H14N4O2
and a molecular weight of 318.34 g/mol. Its IUPAC name is pyrene-1,8-dicarbohydrazide.
Molecular Properties
| Compound Name | pyrene-1,8-dicarbohydrazide |
| PubChem CID | 139611940 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | pyrene-1,8-dicarbohydrazide |
| SMILES | NNC(=O)c1ccc2ccc3ccc(C(=O)NN)c4ccc1c2c34 |
| InChI | InChI=1S/C18H14N4O2/c19-21-17(23)13-5-3-9-1-2-10-4-6-14(18(24)22-20)12-8-7-11(13)15(9)16(10)12/h1-8H,19-20H2,(H,21,23)(H,22,24) |
| InChIKey | HOJKQAYUDPHUSP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene-1,8-dicarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene-1,8-dicarbohydrazide?
The IUPAC name of pyrene-1,8-dicarbohydrazide (CID 139611940) is pyrene-1,8-dicarbohydrazide.
What is the SMILES notation for pyrene-1,8-dicarbohydrazide?
The canonical SMILES for pyrene-1,8-dicarbohydrazide is NNC(=O)c1ccc2ccc3ccc(C(=O)NN)c4ccc1c2c34.
What is the InChIKey of pyrene-1,8-dicarbohydrazide?
The InChIKey is HOJKQAYUDPHUSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O2/c19-21-17(23)13-5-3-9-1-2-10-4-6-14(18(24)22-20)12-8-7-11(13)15(9)16(10)12/h1-8H,19-20H2,(H,21,23)(H,22,24).
What are the key properties of pyrene-1,8-dicarbohydrazide?
pyrene-1,8-dicarbohydrazide has a molecular weight of 318.34 g/mol, XLogP of 1.79, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene-1,8-dicarbohydrazide is sourced from PubChem (CID 139611940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).