C10H16N4 — CID 139612152
N,N-bis(2-methylprop-2-enyl)-1H-1,2,4-triazol-5-amine (PubChem CID 139612152) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N,N-bis(2-methylprop-2-enyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | N,N-bis(2-methylprop-2-enyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 139612152 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N,N-bis(2-methylprop-2-enyl)-1H-1,2,4-triazol-5-amine |
| SMILES | C=C(C)CN(CC(=C)C)c1ncn[nH]1 |
| InChI | InChI=1S/C10H16N4/c1-8(2)5-14(6-9(3)4)10-11-7-12-13-10/h7H,1,3,5-6H2,2,4H3,(H,11,12,13) |
| InChIKey | MYPLLRQUQSUXJT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|