C13H15F3O3S — CID 139612421
(3,3,3-trifluoro-2-hydroxy-1-phenylsulfanylpropyl) butanoate (PubChem CID 139612421) has the molecular formula C13H15F3O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is (3,3,3-trifluoro-2-hydroxy-1-phenylsulfanylpropyl) butanoate.
| Compound Name | (3,3,3-trifluoro-2-hydroxy-1-phenylsulfanylpropyl) butanoate |
|---|---|
| PubChem CID | 139612421 |
| Molecular Formula | C13H15F3O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (3,3,3-trifluoro-2-hydroxy-1-phenylsulfanylpropyl) butanoate |
| SMILES | CCCC(=O)OC(Sc1ccccc1)C(O)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O3S/c1-2-6-10(17)19-12(11(18)13(14,15)16)20-9-7-4-3-5-8-9/h3-5,7-8,11-12,18H,2,6H2,1H3 |
| InChIKey | RWZAKSKSLXAHTE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|