About 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid
6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 139614420) has the molecular formula C8H7ClF2O2
and a molecular weight of 208.59 g/mol. Its IUPAC name is 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 139614420 |
| Molecular Formula | C8H7ClF2O2 |
| Molecular Weight | 208.59 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1(F)C=CC=C(F)C1CCl |
| InChI | InChI=1S/C8H7ClF2O2/c9-4-5-6(10)2-1-3-8(5,11)7(12)13/h1-3,5H,4H2,(H,12,13) |
| InChIKey | PLPLJGJYBHMDIW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.59 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid (CID 139614420) is 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1(F)C=CC=C(F)C1CCl.
What is the InChIKey of 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is PLPLJGJYBHMDIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF2O2/c9-4-5-6(10)2-1-3-8(5,11)7(12)13/h1-3,5H,4H2,(H,12,13).
What are the key properties of 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid?
6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 208.59 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-1,5-difluorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 139614420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).