C31H35N3O7S — CID 139614521
diethyl 2-[(6-cyano-1,3-benzothiazol-2-yl)methyl]-2-[4-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxyphenyl]propanedioate (PubChem CID 139614521) has the molecular formula C31H35N3O7S and a molecular weight of 593.70 g/mol. Its IUPAC name is diethyl 2-[(6-cyano-1,3-benzothiazol-2-yl)methyl]-2-[4-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxyphenyl]propanedioate.
| Compound Name | diethyl 2-[(6-cyano-1,3-benzothiazol-2-yl)methyl]-2-[4-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxyphenyl]propanedioate |
|---|---|
| PubChem CID | 139614521 |
| Molecular Formula | C31H35N3O7S |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | diethyl 2-[(6-cyano-1,3-benzothiazol-2-yl)methyl]-2-[4-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxyphenyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1nc2ccc(C#N)cc2s1)(C(=O)OCC)c1ccc(O[C@H]2CCN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C31H35N3O7S/c1-6-38-27(35)31(28(36)39-7-2,17-26-33-24-13-8-20(18-32)16-25(24)42-26)21-9-11-22(12-10-21)40-23-14-15-34(19-23)29(37)41-30(3,4)5/h8-13,16,23H,6-7,14-15,17,19H2,1-5H3/t23-/m0/s1 |
| InChIKey | HBBNVPIRWVKITR-QHCPKHFHSA-N |
| XLogP | 5.16 |
| TPSA | 128.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|