C16H24N2O4 — CID 139614946
3-methylpentan-3-yl 3-[[2-(hydroxymethyl)pyridine-4-carbonyl]amino]propanoate (PubChem CID 139614946) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-methylpentan-3-yl 3-[[2-(hydroxymethyl)pyridine-4-carbonyl]amino]propanoate.
| Compound Name | 3-methylpentan-3-yl 3-[[2-(hydroxymethyl)pyridine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 139614946 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-methylpentan-3-yl 3-[[2-(hydroxymethyl)pyridine-4-carbonyl]amino]propanoate |
| SMILES | CCC(C)(CC)OC(=O)CCNC(=O)c1ccnc(CO)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-4-16(3,5-2)22-14(20)7-9-18-15(21)12-6-8-17-13(10-12)11-19/h6,8,10,19H,4-5,7,9,11H2,1-3H3,(H,18,21) |
| InChIKey | BTIBQAHBSPZWAC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |