About 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene
1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene (PubChem CID 139615692) has the molecular formula C16H15BrF2O2
and a molecular weight of 357.19 g/mol. Its IUPAC name is 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene |
| PubChem CID | 139615692 |
| Molecular Formula | C16H15BrF2O2 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene |
| SMILES | CC(CCBr)Oc1ccc(Oc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C16H15BrF2O2/c1-11(6-7-17)20-14-2-4-15(5-3-14)21-16-9-12(18)8-13(19)10-16/h2-5,8-11H,6-7H2,1H3 |
| InChIKey | MNONIDXIPDPUOT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene?
The IUPAC name of 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene (CID 139615692) is 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene.
What is the SMILES notation for 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene?
The canonical SMILES for 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene is CC(CCBr)Oc1ccc(Oc2cc(F)cc(F)c2)cc1.
What is the InChIKey of 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene?
The InChIKey is MNONIDXIPDPUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrF2O2/c1-11(6-7-17)20-14-2-4-15(5-3-14)21-16-9-12(18)8-13(19)10-16/h2-5,8-11H,6-7H2,1H3.
What are the key properties of 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene?
1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene has a molecular weight of 357.19 g/mol, XLogP of 5.31, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-bromobutan-2-yloxy)phenoxy]-3,5-difluorobenzene is sourced from PubChem (CID 139615692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).