C26H18F6N2OS — CID 139615763
3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene-6-carbonitrile (PubChem CID 139615763) has the molecular formula C26H18F6N2OS and a molecular weight of 520.50 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene-6-carbonitrile.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene-6-carbonitrile |
|---|---|
| PubChem CID | 139615763 |
| Molecular Formula | C26H18F6N2OS |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(5-methoxy-1,2-dimethylindol-3-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene-6-carbonitrile |
| SMILES | COc1ccc2c(c1)c(C1=C(c3c(C)sc4cc(C#N)ccc34)C(F)(F)C(F)(F)C1(F)F)c(C)n2C |
| InChI | InChI=1S/C26H18F6N2OS/c1-12-20(17-10-15(35-4)6-8-18(17)34(12)3)22-23(25(29,30)26(31,32)24(22,27)28)21-13(2)36-19-9-14(11-33)5-7-16(19)21/h5-10H,1-4H3 |
| InChIKey | NJCVLWWHTYOHJM-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|