About 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene
3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene (PubChem CID 139615895) has the molecular formula C27H38O8P2S
and a molecular weight of 584.61 g/mol. Its IUPAC name is 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene.
Molecular Properties
| Compound Name | 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene |
| PubChem CID | 139615895 |
| Molecular Formula | C27H38O8P2S |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene |
| SMILES | CCOP(=O)(OCC)C(CCc1c(-c2ccc(OC)cc2)sc2cc(OC)ccc12)P(=O)(OCC)OCC |
| InChI | InChI=1S/C27H38O8P2S/c1-7-32-36(28,33-8-2)26(37(29,34-9-3)35-10-4)18-17-24-23-16-15-22(31-6)19-25(23)38-27(24)20-11-13-21(30-5)14-12-20/h11-16,19,26H,7-10,17-18H2,1-6H3 |
| InChIKey | XYECOIDRIHRNRU-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene?
The IUPAC name of 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene (CID 139615895) is 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene.
What is the SMILES notation for 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene?
The canonical SMILES for 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene is CCOP(=O)(OCC)C(CCc1c(-c2ccc(OC)cc2)sc2cc(OC)ccc12)P(=O)(OCC)OCC.
What is the InChIKey of 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene?
The InChIKey is XYECOIDRIHRNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38O8P2S/c1-7-32-36(28,33-8-2)26(37(29,34-9-3)35-10-4)18-17-24-23-16-15-22(31-6)19-25(23)38-27(24)20-11-13-21(30-5)14-12-20/h11-16,19,26H,7-10,17-18H2,1-6H3.
What are the key properties of 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene?
3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene has a molecular weight of 584.61 g/mol, XLogP of 8.38, 16 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-bis(diethoxyphosphoryl)propyl]-6-methoxy-2-(4-methoxyphenyl)-1-benzothiophene is sourced from PubChem (CID 139615895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).