C21H31BrO4Si — CID 139616245
(2S,3R)-1-(4-bromobut-2-ynyl)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]cyclopent-4-ene-1,3-diol (PubChem CID 139616245) has the molecular formula C21H31BrO4Si and a molecular weight of 455.47 g/mol. Its IUPAC name is (2S,3R)-1-(4-bromobut-2-ynyl)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]cyclopent-4-ene-1,3-diol.
| Compound Name | (2S,3R)-1-(4-bromobut-2-ynyl)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]cyclopent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 139616245 |
| Molecular Formula | C21H31BrO4Si |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (2S,3R)-1-(4-bromobut-2-ynyl)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]cyclopent-4-ene-1,3-diol |
| SMILES | C/C(C#CC1=C[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C1(O)CC#CCBr)=C/CO |
| InChI | InChI=1S/C21H31BrO4Si/c1-16(11-14-23)9-10-17-15-18(24)19(21(17,25)12-7-8-13-22)26-27(5,6)20(2,3)4/h11,15,18-19,23-25H,12-14H2,1-6H3/b16-11-/t18-,19+,21?/m1/s1 |
| InChIKey | RNNSVGZQPQAYRD-XUGZZIBNSA-N |
| XLogP | 3.14 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|