C14H13Cl2F3O2 — CID 139616502
1-[3-(4,4-dichloro-5,5,5-trifluoropent-1-en-2-yl)phenoxy]propan-2-one (PubChem CID 139616502) has the molecular formula C14H13Cl2F3O2 and a molecular weight of 341.16 g/mol. Its IUPAC name is 1-[3-(4,4-dichloro-5,5,5-trifluoropent-1-en-2-yl)phenoxy]propan-2-one.
| Compound Name | 1-[3-(4,4-dichloro-5,5,5-trifluoropent-1-en-2-yl)phenoxy]propan-2-one |
|---|---|
| PubChem CID | 139616502 |
| Molecular Formula | C14H13Cl2F3O2 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-[3-(4,4-dichloro-5,5,5-trifluoropent-1-en-2-yl)phenoxy]propan-2-one |
| SMILES | C=C(CC(Cl)(Cl)C(F)(F)F)c1cccc(OCC(C)=O)c1 |
| InChI | InChI=1S/C14H13Cl2F3O2/c1-9(7-13(15,16)14(17,18)19)11-4-3-5-12(6-11)21-8-10(2)20/h3-6H,1,7-8H2,2H3 |
| InChIKey | GRAIJAIZMPOXLZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|