C10H6O5 — CID 139616658
4-(hydroxymethylidene)-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione (PubChem CID 139616658) has the molecular formula C10H6O5 and a molecular weight of 206.15 g/mol. Its IUPAC name is 4-(hydroxymethylidene)-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione.
| Compound Name | 4-(hydroxymethylidene)-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione |
|---|---|
| PubChem CID | 139616658 |
| Molecular Formula | C10H6O5 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 4-(hydroxymethylidene)-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione |
| SMILES | O=C1OC(=CO)OC(=O)c2ccc1cc2 |
| InChI | InChI=1S/C10H6O5/c11-5-8-14-9(12)6-1-2-7(4-3-6)10(13)15-8/h1-5,11H |
| InChIKey | ZXCNWAGLWLFNBA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|