C20H23ClFNO4S — CID 139616798
methyl 7-[(4-chlorophenyl)sulfonylamino]-7-(3-fluorophenyl)heptanoate (PubChem CID 139616798) has the molecular formula C20H23ClFNO4S and a molecular weight of 427.93 g/mol. Its IUPAC name is methyl 7-[(4-chlorophenyl)sulfonylamino]-7-(3-fluorophenyl)heptanoate.
| Compound Name | methyl 7-[(4-chlorophenyl)sulfonylamino]-7-(3-fluorophenyl)heptanoate |
|---|---|
| PubChem CID | 139616798 |
| Molecular Formula | C20H23ClFNO4S |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | methyl 7-[(4-chlorophenyl)sulfonylamino]-7-(3-fluorophenyl)heptanoate |
| SMILES | COC(=O)CCCCCC(NS(=O)(=O)c1ccc(Cl)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H23ClFNO4S/c1-27-20(24)9-4-2-3-8-19(15-6-5-7-17(22)14-15)23-28(25,26)18-12-10-16(21)11-13-18/h5-7,10-14,19,23H,2-4,8-9H2,1H3 |
| InChIKey | BTSWPLDMDQCDEL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|