C26H13F29O3 — CID 139617680
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,16,16,16-nonacosafluorohexadecyl 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 139617680) has the molecular formula C26H13F29O3 and a molecular weight of 924.33 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,16,16,16-nonacosafluorohexadecyl 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,16,16,16-nonacosafluorohexadecyl 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 139617680 |
| Molecular Formula | C26H13F29O3 |
| Molecular Weight | 924.33 g/mol |
| Exact Mass | 924.04 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,16,16,16-nonacosafluorohexadecyl 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H13F29O3/c1-57-11-5-2-10(3-6-11)4-7-12(56)58-26(54,55)25(52,53)24(50,51)23(48,49)22(46,47)21(44,45)20(42,43)19(40,41)18(38,39)17(36,37)16(34,35)15(32,33)13(27,28)8-9-14(29,30)31/h2-7H,8-9H2,1H3 |
| InChIKey | QGLBNVQHTHZQKL-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.33 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|