C45H37N5O6S2 — CID 139618558
benzhydryl (6R)-3-hydroxy-7-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139618558) has the molecular formula C45H37N5O6S2 and a molecular weight of 807.95 g/mol. Its IUPAC name is benzhydryl (6R)-3-hydroxy-7-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-hydroxy-7-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139618558 |
| Molecular Formula | C45H37N5O6S2 |
| Molecular Weight | 807.95 g/mol |
| Exact Mass | 807.22 |
| IUPAC Name | benzhydryl (6R)-3-hydroxy-7-[[(2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(O)CS[C@H]12)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C45H37N5O6S2/c1-55-49-36(34-27-58-44(46-34)48-45(31-21-11-4-12-22-31,32-23-13-5-14-24-32)33-25-15-6-16-26-33)40(52)47-37-41(53)50-38(35(51)28-57-42(37)50)43(54)56-39(29-17-7-2-8-18-29)30-19-9-3-10-20-30/h2-27,37,39,42,51H,28H2,1H3,(H,46,48)(H,47,52)/b49-36-/t37?,42-/m1/s1 |
| InChIKey | FHDRTFXWRHARQO-UXHIEBMBSA-N |
| XLogP | 7.40 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.95 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|