About 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine
3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine (PubChem CID 139618918) has the molecular formula C11H5Cl3F5N3OS
and a molecular weight of 428.60 g/mol. Its IUPAC name is 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine |
| PubChem CID | 139618918 |
| Molecular Formula | C11H5Cl3F5N3OS |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 426.91 |
| IUPAC Name | 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine |
| SMILES | Nc1c(SC(F)(F)F)c(OC(F)F)nn1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H5Cl3F5N3OS/c12-3-1-4(13)6(5(14)2-3)22-8(20)7(24-11(17,18)19)9(21-22)23-10(15)16/h1-2,10H,20H2 |
| InChIKey | VEHCNFJHJZKECM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine?
The IUPAC name of 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine (CID 139618918) is 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine.
What is the SMILES notation for 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine?
The canonical SMILES for 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine is Nc1c(SC(F)(F)F)c(OC(F)F)nn1-c1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine?
The InChIKey is VEHCNFJHJZKECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl3F5N3OS/c12-3-1-4(13)6(5(14)2-3)22-8(20)7(24-11(17,18)19)9(21-22)23-10(15)16/h1-2,10H,20H2.
What are the key properties of 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine?
3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine has a molecular weight of 428.60 g/mol, XLogP of 5.63, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-1-(2,4,6-trichlorophenyl)-4-(trifluoromethylsulfanyl)pyrazol-5-amine is sourced from PubChem (CID 139618918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).