About 1-cyclohexylethenyl carbamate
1-cyclohexylethenyl carbamate (PubChem CID 139620629) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 1-cyclohexylethenyl carbamate.
Molecular Properties
| Compound Name | 1-cyclohexylethenyl carbamate |
| PubChem CID | 139620629 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 1-cyclohexylethenyl carbamate |
| SMILES | C=C(OC(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C9H15NO2/c1-7(12-9(10)11)8-5-3-2-4-6-8/h8H,1-6H2,(H2,10,11) |
| InChIKey | XQYBHTMDFLJNGW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylethenyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethenyl carbamate?
The IUPAC name of 1-cyclohexylethenyl carbamate (CID 139620629) is 1-cyclohexylethenyl carbamate.
What is the SMILES notation for 1-cyclohexylethenyl carbamate?
The canonical SMILES for 1-cyclohexylethenyl carbamate is C=C(OC(N)=O)C1CCCCC1.
What is the InChIKey of 1-cyclohexylethenyl carbamate?
The InChIKey is XQYBHTMDFLJNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-7(12-9(10)11)8-5-3-2-4-6-8/h8H,1-6H2,(H2,10,11).
What are the key properties of 1-cyclohexylethenyl carbamate?
1-cyclohexylethenyl carbamate has a molecular weight of 169.22 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethenyl carbamate is sourced from PubChem (CID 139620629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).