C28H52O4Sn — CID 139621347
5,6-dibutyl-2,2-dioctyl-1,3,2-dioxastannepine-4,7-dione (PubChem CID 139621347) has the molecular formula C28H52O4Sn and a molecular weight of 571.43 g/mol. Its IUPAC name is 5,6-dibutyl-2,2-dioctyl-1,3,2-dioxastannepine-4,7-dione.
| Compound Name | 5,6-dibutyl-2,2-dioctyl-1,3,2-dioxastannepine-4,7-dione |
|---|---|
| PubChem CID | 139621347 |
| Molecular Formula | C28H52O4Sn |
| Molecular Weight | 571.43 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 5,6-dibutyl-2,2-dioctyl-1,3,2-dioxastannepine-4,7-dione |
| SMILES | CCCCCCCC[Sn]1(CCCCCCCC)OC(=O)C(CCCC)=C(CCCC)C(=O)O1 |
| InChI | InChI=1S/C12H20O4.2C8H17.Sn/c1-3-5-7-9(11(13)14)10(12(15)16)8-6-4-2;2*1-3-5-7-8-6-4-2;/h3-8H2,1-2H3,(H,13,14)(H,15,16);2*1,3-8H2,2H3;/q;;;+2/p-2/b10-9-;;; |
| InChIKey | ICQXJPXZANGSTH-BZKIHGKGSA-L |
| XLogP | 8.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.43 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|