About 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine
2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine (PubChem CID 139621517) has the molecular formula C15H23FN2O4
and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine |
| PubChem CID | 139621517 |
| Molecular Formula | C15H23FN2O4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine |
| SMILES | CCOCC1(F)CCCCC1Oc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C15H23FN2O4/c1-4-21-10-15(16)8-6-5-7-11(15)22-14-17-12(19-2)9-13(18-14)20-3/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | IVSBNARPDUOZMZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine?
The IUPAC name of 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine (CID 139621517) is 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine.
What is the SMILES notation for 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine?
The canonical SMILES for 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine is CCOCC1(F)CCCCC1Oc1nc(OC)cc(OC)n1.
What is the InChIKey of 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine?
The InChIKey is IVSBNARPDUOZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23FN2O4/c1-4-21-10-15(16)8-6-5-7-11(15)22-14-17-12(19-2)9-13(18-14)20-3/h9,11H,4-8,10H2,1-3H3.
What are the key properties of 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine?
2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine has a molecular weight of 314.36 g/mol, XLogP of 2.56, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(ethoxymethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine is sourced from PubChem (CID 139621517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).