About [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol
[2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol (PubChem CID 139621518) has the molecular formula C13H19FN2O4
and a molecular weight of 286.30 g/mol. Its IUPAC name is [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol.
Molecular Properties
| Compound Name | [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol |
| PubChem CID | 139621518 |
| Molecular Formula | C13H19FN2O4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol |
| SMILES | COc1cc(OC)nc(OC2CCCCC2(F)CO)n1 |
| InChI | InChI=1S/C13H19FN2O4/c1-18-10-7-11(19-2)16-12(15-10)20-9-5-3-4-6-13(9,14)8-17/h7,9,17H,3-6,8H2,1-2H3 |
| InChIKey | VKFMZBIQQQQEED-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol?
The IUPAC name of [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol (CID 139621518) is [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol.
What is the SMILES notation for [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol?
The canonical SMILES for [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol is COc1cc(OC)nc(OC2CCCCC2(F)CO)n1.
What is the InChIKey of [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol?
The InChIKey is VKFMZBIQQQQEED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2O4/c1-18-10-7-11(19-2)16-12(15-10)20-9-5-3-4-6-13(9,14)8-17/h7,9,17H,3-6,8H2,1-2H3.
What are the key properties of [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol?
[2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol has a molecular weight of 286.30 g/mol, XLogP of 1.52, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,6-dimethoxypyrimidin-2-yl)oxy-1-fluorocyclohexyl]methanol is sourced from PubChem (CID 139621518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).