About 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine
2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine (PubChem CID 139621519) has the molecular formula C13H18FN5O3
and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine |
| PubChem CID | 139621519 |
| Molecular Formula | C13H18FN5O3 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(OC2CCCCC2(F)CN=[N+]=[N-])n1 |
| InChI | InChI=1S/C13H18FN5O3/c1-20-10-7-11(21-2)18-12(17-10)22-9-5-3-4-6-13(9,14)8-16-19-15/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | ODPQLFUUDAYYJO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine?
The IUPAC name of 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine (CID 139621519) is 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine.
What is the SMILES notation for 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine?
The canonical SMILES for 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine is COc1cc(OC)nc(OC2CCCCC2(F)CN=[N+]=[N-])n1.
What is the InChIKey of 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine?
The InChIKey is ODPQLFUUDAYYJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN5O3/c1-20-10-7-11(21-2)18-12(17-10)22-9-5-3-4-6-13(9,14)8-16-19-15/h7,9H,3-6,8H2,1-2H3.
What are the key properties of 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine?
2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine has a molecular weight of 311.32 g/mol, XLogP of 2.83, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(azidomethyl)-2-fluorocyclohexyl]oxy-4,6-dimethoxypyrimidine is sourced from PubChem (CID 139621519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).