C10H6BF10NO2 — CID 139621690
[3-amino-2,5-bis(1,1,2,2,2-pentafluoroethyl)phenyl]boronic acid (PubChem CID 139621690) has the molecular formula C10H6BF10NO2 and a molecular weight of 372.96 g/mol. Its IUPAC name is [3-amino-2,5-bis(1,1,2,2,2-pentafluoroethyl)phenyl]boronic acid.
| Compound Name | [3-amino-2,5-bis(1,1,2,2,2-pentafluoroethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 139621690 |
| Molecular Formula | C10H6BF10NO2 |
| Molecular Weight | 372.96 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [3-amino-2,5-bis(1,1,2,2,2-pentafluoroethyl)phenyl]boronic acid |
| SMILES | Nc1cc(C(F)(F)C(F)(F)F)cc(B(O)O)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6BF10NO2/c12-7(13,9(16,17)18)3-1-4(11(23)24)6(5(22)2-3)8(14,15)10(19,20)21/h1-2,23-24H,22H2 |
| InChIKey | OXBBMCWFDYNXLP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.96 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|