C33H29F6NO2S — CID 139622227
3-[3,3,4,4,5,5-hexafluoro-2-[5-[4-(4-methoxyphenyl)buta-1,3-dienyl]-2,4-dimethylthiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole (PubChem CID 139622227) has the molecular formula C33H29F6NO2S and a molecular weight of 617.66 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[5-[4-(4-methoxyphenyl)buta-1,3-dienyl]-2,4-dimethylthiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-[4-(4-methoxyphenyl)buta-1,3-dienyl]-2,4-dimethylthiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 139622227 |
| Molecular Formula | C33H29F6NO2S |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-[4-(4-methoxyphenyl)buta-1,3-dienyl]-2,4-dimethylthiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
| SMILES | COc1ccc(C=CC=Cc2sc(C)c(C3=C(c4c(C)n(C)c5ccc(OC)cc45)C(F)(F)C(F)(F)C3(F)F)c2C)cc1 |
| InChI | InChI=1S/C33H29F6NO2S/c1-18-26(10-8-7-9-21-11-13-22(41-5)14-12-21)43-20(3)27(18)29-30(32(36,37)33(38,39)31(29,34)35)28-19(2)40(4)25-16-15-23(42-6)17-24(25)28/h7-17H,1-6H3 |
| InChIKey | SAGBPIWOMJEXOF-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|