About 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one
5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 1396226) has the molecular formula C15H13N3O4S
and a molecular weight of 331.35 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| PubChem CID | 1396226 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(C2CC2)c(O)c1/C=N/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13N3O4S/c19-13-10(14(20)18(9-2-3-9)15(23)17-13)6-16-8-1-4-11-12(5-8)22-7-21-11/h1,4-6,9,20H,2-3,7H2,(H,17,19,23)/b16-6+ |
| InChIKey | ODJYLSGAABJFNA-OMCISZLKSA-N |
| XLogP | 2.43 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one?
The IUPAC name of 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one (CID 1396226) is 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
What is the SMILES notation for 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one?
The canonical SMILES for 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one is O=c1[nH]c(=S)n(C2CC2)c(O)c1/C=N/c1ccc2c(c1)OCO2.
What is the InChIKey of 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one?
The InChIKey is ODJYLSGAABJFNA-OMCISZLKSA-N. The full InChI is InChI=1S/C15H13N3O4S/c19-13-10(14(20)18(9-2-3-9)15(23)17-13)6-16-8-1-4-11-12(5-8)22-7-21-11/h1,4-6,9,20H,2-3,7H2,(H,17,19,23)/b16-6+.
What are the key properties of 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one?
5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one has a molecular weight of 331.35 g/mol, XLogP of 2.43, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-yliminomethyl)-1-cyclopropyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one is sourced from PubChem (CID 1396226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).