C17H18N4O5 — CID 139622913
1-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-oxopyrimidin-4-yl]-3-phenylurea (PubChem CID 139622913) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 1-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-oxopyrimidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-oxopyrimidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 139622913 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]-2-oxopyrimidin-4-yl]-3-phenylurea |
| SMILES | C=C1[C@H](n2ccc(NC(=O)Nc3ccccc3)nc2=O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C17H18N4O5/c1-10-14(23)12(9-22)26-15(10)21-8-7-13(20-17(21)25)19-16(24)18-11-5-3-2-4-6-11/h2-8,12,14-15,22-23H,1,9H2,(H2,18,19,20,24,25)/t12-,14+,15-/m1/s1 |
| InChIKey | XZGYOZCIJIMBBI-VHDGCEQUSA-N |
| XLogP | 0.69 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|