C36H57NO5Si3 — CID 139623147
1-[3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]prop-2-enoyl]-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroquinolin-2-one (PubChem CID 139623147) has the molecular formula C36H57NO5Si3 and a molecular weight of 668.11 g/mol. Its IUPAC name is 1-[3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]prop-2-enoyl]-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]prop-2-enoyl]-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 139623147 |
| Molecular Formula | C36H57NO5Si3 |
| Molecular Weight | 668.11 g/mol |
| Exact Mass | 667.35 |
| IUPAC Name | 1-[3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]prop-2-enoyl]-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroquinolin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CCC(=O)N2C(=O)C=Cc1ccc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C36H57NO5Si3/c1-34(2,3)43(10,11)40-28-19-20-29-27(25-28)18-23-33(39)37(29)32(38)22-17-26-16-21-30(41-44(12,13)35(4,5)6)31(24-26)42-45(14,15)36(7,8)9/h16-17,19-22,24-25H,18,23H2,1-15H3 |
| InChIKey | KKPYRSDIVWAOAH-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.11 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|