C18H14N2O6 — CID 139623155
1-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-6-nitro-3,4-dihydroquinolin-2-one (PubChem CID 139623155) has the molecular formula C18H14N2O6 and a molecular weight of 354.32 g/mol. Its IUPAC name is 1-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-6-nitro-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-6-nitro-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 139623155 |
| Molecular Formula | C18H14N2O6 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-6-nitro-3,4-dihydroquinolin-2-one |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)N1C(=O)CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H14N2O6/c21-15-6-1-11(9-16(15)22)2-7-17(23)19-14-5-4-13(20(25)26)10-12(14)3-8-18(19)24/h1-2,4-7,9-10,21-22H,3,8H2 |
| InChIKey | PYUDLEPJSMOSLF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|