About 3-hexa-1,3-dienylbenzene-1,2-diol
3-hexa-1,3-dienylbenzene-1,2-diol (PubChem CID 139623398) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-hexa-1,3-dienylbenzene-1,2-diol.
Molecular Properties
| Compound Name | 3-hexa-1,3-dienylbenzene-1,2-diol |
| PubChem CID | 139623398 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3-hexa-1,3-dienylbenzene-1,2-diol |
| SMILES | CCC=CC=Cc1cccc(O)c1O |
| InChI | InChI=1S/C12H14O2/c1-2-3-4-5-7-10-8-6-9-11(13)12(10)14/h3-9,13-14H,2H2,1H3 |
| InChIKey | QQPIDNJPLUGQGM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-hexa-1,3-dienylbenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexa-1,3-dienylbenzene-1,2-diol?
The IUPAC name of 3-hexa-1,3-dienylbenzene-1,2-diol (CID 139623398) is 3-hexa-1,3-dienylbenzene-1,2-diol.
What is the SMILES notation for 3-hexa-1,3-dienylbenzene-1,2-diol?
The canonical SMILES for 3-hexa-1,3-dienylbenzene-1,2-diol is CCC=CC=Cc1cccc(O)c1O.
What is the InChIKey of 3-hexa-1,3-dienylbenzene-1,2-diol?
The InChIKey is QQPIDNJPLUGQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-2-3-4-5-7-10-8-6-9-11(13)12(10)14/h3-9,13-14H,2H2,1H3.
What are the key properties of 3-hexa-1,3-dienylbenzene-1,2-diol?
3-hexa-1,3-dienylbenzene-1,2-diol has a molecular weight of 190.24 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexa-1,3-dienylbenzene-1,2-diol is sourced from PubChem (CID 139623398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).