C22H30O8S3 — CID 139623450
1,2,4,5-tetramethoxy-3-methylsulfanyl-6-(2,3,5,6-tetramethoxy-4-methylsulfanylphenyl)sulfanylbenzene (PubChem CID 139623450) has the molecular formula C22H30O8S3 and a molecular weight of 518.68 g/mol. Its IUPAC name is 1,2,4,5-tetramethoxy-3-methylsulfanyl-6-(2,3,5,6-tetramethoxy-4-methylsulfanylphenyl)sulfanylbenzene.
| Compound Name | 1,2,4,5-tetramethoxy-3-methylsulfanyl-6-(2,3,5,6-tetramethoxy-4-methylsulfanylphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 139623450 |
| Molecular Formula | C22H30O8S3 |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 1,2,4,5-tetramethoxy-3-methylsulfanyl-6-(2,3,5,6-tetramethoxy-4-methylsulfanylphenyl)sulfanylbenzene |
| SMILES | COc1c(OC)c(Sc2c(OC)c(OC)c(SC)c(OC)c2OC)c(OC)c(OC)c1SC |
| InChI | InChI=1S/C22H30O8S3/c1-23-11-15(27-5)21(16(28-6)12(24-2)19(11)31-9)33-22-17(29-7)13(25-3)20(32-10)14(26-4)18(22)30-8/h1-10H3 |
| InChIKey | ROTFLXXKZOKJHA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |