C24H34S3 — CID 139623515
1-ethylsulfanyl-4-(4-ethylsulfanyl-2,3,5,6-tetramethylphenyl)sulfanyl-2,3,5,6-tetramethylbenzene (PubChem CID 139623515) has the molecular formula C24H34S3 and a molecular weight of 418.74 g/mol. Its IUPAC name is 1-ethylsulfanyl-4-(4-ethylsulfanyl-2,3,5,6-tetramethylphenyl)sulfanyl-2,3,5,6-tetramethylbenzene.
| Compound Name | 1-ethylsulfanyl-4-(4-ethylsulfanyl-2,3,5,6-tetramethylphenyl)sulfanyl-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 139623515 |
| Molecular Formula | C24H34S3 |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-ethylsulfanyl-4-(4-ethylsulfanyl-2,3,5,6-tetramethylphenyl)sulfanyl-2,3,5,6-tetramethylbenzene |
| SMILES | CCSc1c(C)c(C)c(Sc2c(C)c(C)c(SCC)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C24H34S3/c1-11-25-21-13(3)17(7)23(18(8)14(21)4)27-24-19(9)15(5)22(26-12-2)16(6)20(24)10/h11-12H2,1-10H3 |
| InChIKey | OYNDASCLJWHHAB-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |