C32H50S3 — CID 139623520
1,2,4,5-tetraethyl-3-ethylsulfanyl-6-(2,3,5,6-tetraethyl-4-ethylsulfanylphenyl)sulfanylbenzene (PubChem CID 139623520) has the molecular formula C32H50S3 and a molecular weight of 530.95 g/mol. Its IUPAC name is 1,2,4,5-tetraethyl-3-ethylsulfanyl-6-(2,3,5,6-tetraethyl-4-ethylsulfanylphenyl)sulfanylbenzene.
| Compound Name | 1,2,4,5-tetraethyl-3-ethylsulfanyl-6-(2,3,5,6-tetraethyl-4-ethylsulfanylphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 139623520 |
| Molecular Formula | C32H50S3 |
| Molecular Weight | 530.95 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | 1,2,4,5-tetraethyl-3-ethylsulfanyl-6-(2,3,5,6-tetraethyl-4-ethylsulfanylphenyl)sulfanylbenzene |
| SMILES | CCSc1c(CC)c(CC)c(Sc2c(CC)c(CC)c(SCC)c(CC)c2CC)c(CC)c1CC |
| InChI | InChI=1S/C32H50S3/c1-11-21-25(15-5)31(26(16-6)22(12-2)29(21)33-19-9)35-32-27(17-7)23(13-3)30(34-20-10)24(14-4)28(32)18-8/h11-20H2,1-10H3 |
| InChIKey | UCSUMMCSTOFMPO-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.95 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |