About methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate
methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate (PubChem CID 139623985) has the molecular formula C17H34O3Si
and a molecular weight of 314.54 g/mol. Its IUPAC name is methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate.
Molecular Properties
| Compound Name | methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate |
| PubChem CID | 139623985 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate |
| SMILES | COC(=O)C[C@@H](C)[C@H](CC=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-13(2)10-11-15(14(3)12-16(18)19-7)20-21(8,9)17(4,5)6/h10,14-15H,11-12H2,1-9H3/t14-,15+/m1/s1 |
| InChIKey | YONYVIFXZQRFEG-CABCVRRESA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate?
The IUPAC name of methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate (CID 139623985) is methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate.
What is the SMILES notation for methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate?
The canonical SMILES for methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate is COC(=O)C[C@@H](C)[C@H](CC=C(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate?
The InChIKey is YONYVIFXZQRFEG-CABCVRRESA-N. The full InChI is InChI=1S/C17H34O3Si/c1-13(2)10-11-15(14(3)12-16(18)19-7)20-21(8,9)17(4,5)6/h10,14-15H,11-12H2,1-9H3/t14-,15+/m1/s1.
What are the key properties of methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate?
methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate has a molecular weight of 314.54 g/mol, XLogP of 4.93, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enoate is sourced from PubChem (CID 139623985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).