C23H38O3 — CID 139623999
1,3-bis[(1S,2R,3R,5R)-3-methoxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]propan-2-one (PubChem CID 139623999) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is 1,3-bis[(1S,2R,3R,5R)-3-methoxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]propan-2-one.
| Compound Name | 1,3-bis[(1S,2R,3R,5R)-3-methoxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]propan-2-one |
|---|---|
| PubChem CID | 139623999 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1,3-bis[(1S,2R,3R,5R)-3-methoxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]propan-2-one |
| SMILES | C=C(C)[C@@H]1C[C@@H](OC)[C@H](C)[C@H]1CC(=O)C[C@@H]1[C@@H](C)[C@H](OC)C[C@H]1C(=C)C |
| InChI | InChI=1S/C23H38O3/c1-13(2)18-11-22(25-7)15(5)20(18)9-17(24)10-21-16(6)23(26-8)12-19(21)14(3)4/h15-16,18-23H,1,3,9-12H2,2,4-8H3/t15-,16-,18+,19+,20-,21-,22-,23-/m1/s1 |
| InChIKey | ANSFELOCIHKOBE-NMYAZUGSSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|