About 7-butoxy-1,2-benzoxazole
7-butoxy-1,2-benzoxazole (PubChem CID 139624373) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 7-butoxy-1,2-benzoxazole.
Molecular Properties
| Compound Name | 7-butoxy-1,2-benzoxazole |
| PubChem CID | 139624373 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 7-butoxy-1,2-benzoxazole |
| SMILES | CCCCOc1cccc2cnoc12 |
| InChI | InChI=1S/C11H13NO2/c1-2-3-7-13-10-6-4-5-9-8-12-14-11(9)10/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | GJNBZLGTENPNRC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-butoxy-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butoxy-1,2-benzoxazole?
The IUPAC name of 7-butoxy-1,2-benzoxazole (CID 139624373) is 7-butoxy-1,2-benzoxazole.
What is the SMILES notation for 7-butoxy-1,2-benzoxazole?
The canonical SMILES for 7-butoxy-1,2-benzoxazole is CCCCOc1cccc2cnoc12.
What is the InChIKey of 7-butoxy-1,2-benzoxazole?
The InChIKey is GJNBZLGTENPNRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-3-7-13-10-6-4-5-9-8-12-14-11(9)10/h4-6,8H,2-3,7H2,1H3.
What are the key properties of 7-butoxy-1,2-benzoxazole?
7-butoxy-1,2-benzoxazole has a molecular weight of 191.23 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butoxy-1,2-benzoxazole is sourced from PubChem (CID 139624373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).