About [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid
[(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid (PubChem CID 139624648) has the molecular formula C10H15NO6P2
and a molecular weight of 307.18 g/mol. Its IUPAC name is [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid.
Molecular Properties
| Compound Name | [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid |
| PubChem CID | 139624648 |
| Molecular Formula | C10H15NO6P2 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(NC1Cc2ccccc2C1)P(=O)(O)O |
| InChI | InChI=1S/C10H15NO6P2/c12-18(13,14)10(19(15,16)17)11-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-11H,5-6H2,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | JNWNFJQOURSLPP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid?
The IUPAC name of [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid (CID 139624648) is [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid.
What is the SMILES notation for [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid?
The canonical SMILES for [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid is O=P(O)(O)C(NC1Cc2ccccc2C1)P(=O)(O)O.
What is the InChIKey of [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid?
The InChIKey is JNWNFJQOURSLPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO6P2/c12-18(13,14)10(19(15,16)17)11-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-11H,5-6H2,(H2,12,13,14)(H2,15,16,17).
What are the key properties of [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid?
[(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid has a molecular weight of 307.18 g/mol, XLogP of 0.38, 4 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,3-dihydro-1H-inden-2-ylamino)-phosphonomethyl]phosphonic acid is sourced from PubChem (CID 139624648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).