C16H13FN2O6S — CID 139625860
2-[5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-2-nitrophenyl]sulfanylacetic acid (PubChem CID 139625860) has the molecular formula C16H13FN2O6S and a molecular weight of 380.35 g/mol. Its IUPAC name is 2-[5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-2-nitrophenyl]sulfanylacetic acid.
| Compound Name | 2-[5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-2-nitrophenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 139625860 |
| Molecular Formula | C16H13FN2O6S |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-[5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-2-nitrophenyl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13FN2O6S/c17-10-5-12(19(24)25)13(26-7-14(20)21)6-11(10)18-15(22)8-3-1-2-4-9(8)16(18)23/h5-6H,1-4,7H2,(H,20,21) |
| InChIKey | DPUGDLQFPXMPJZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|