About 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid
2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid (PubChem CID 139627310) has the molecular formula C20H23NO3
and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid.
Molecular Properties
| Compound Name | 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid |
| PubChem CID | 139627310 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1cccc(Nc2cc(C)c(O)c(C)c2C)c1)C(=O)O |
| InChI | InChI=1S/C20H23NO3/c1-5-16(20(23)24)10-15-7-6-8-17(11-15)21-18-9-12(2)19(22)14(4)13(18)3/h6-11,21-22H,5H2,1-4H3,(H,23,24) |
| InChIKey | HJIJKSORUKJKPG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid?
The IUPAC name of 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid (CID 139627310) is 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid.
What is the SMILES notation for 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid?
The canonical SMILES for 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid is CCC(=Cc1cccc(Nc2cc(C)c(O)c(C)c2C)c1)C(=O)O.
What is the InChIKey of 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid?
The InChIKey is HJIJKSORUKJKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3/c1-5-16(20(23)24)10-15-7-6-8-17(11-15)21-18-9-12(2)19(22)14(4)13(18)3/h6-11,21-22H,5H2,1-4H3,(H,23,24).
What are the key properties of 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid?
2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid has a molecular weight of 325.41 g/mol, XLogP of 4.94, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(4-hydroxy-2,3,5-trimethylanilino)phenyl]methylidene]butanoic acid is sourced from PubChem (CID 139627310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).