C11H20O2 — CID 139627974
2-(4-ethylcyclohexyl)prop-1-ene-1,3-diol (PubChem CID 139627974) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(4-ethylcyclohexyl)prop-1-ene-1,3-diol.
| Compound Name | 2-(4-ethylcyclohexyl)prop-1-ene-1,3-diol |
|---|---|
| PubChem CID | 139627974 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-(4-ethylcyclohexyl)prop-1-ene-1,3-diol |
| SMILES | CCC1CCC(C(=CO)CO)CC1 |
| InChI | InChI=1S/C11H20O2/c1-2-9-3-5-10(6-4-9)11(7-12)8-13/h7,9-10,12-13H,2-6,8H2,1H3 |
| InChIKey | CECIVUKGNJJNIT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|