C21H30N4O — CID 139628751
2,2,5,5-tetramethyl-N-[3-(2-methyl-2H-quinazolin-3-yl)propyl]-1H-pyrrole-3-carboxamide (PubChem CID 139628751) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[3-(2-methyl-2H-quinazolin-3-yl)propyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2,2,5,5-tetramethyl-N-[3-(2-methyl-2H-quinazolin-3-yl)propyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 139628751 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[3-(2-methyl-2H-quinazolin-3-yl)propyl]-1H-pyrrole-3-carboxamide |
| SMILES | CC1N=c2ccccc2=CN1CCCNC(=O)C1=CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C21H30N4O/c1-15-23-18-10-7-6-9-16(18)14-25(15)12-8-11-22-19(26)17-13-20(2,3)24-21(17,4)5/h6-7,9-10,13-15,24H,8,11-12H2,1-5H3,(H,22,26) |
| InChIKey | NGISYAZSTPPHCQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|