C8H2ClF6NO — CID 139628871
1-[6-chloro-4-(trifluoromethyl)-3-pyridinyl]-2,2,2-trifluoroethanone (PubChem CID 139628871) has the molecular formula C8H2ClF6NO and a molecular weight of 277.55 g/mol. Its IUPAC name is 1-[6-chloro-4-(trifluoromethyl)-3-pyridinyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[6-chloro-4-(trifluoromethyl)-3-pyridinyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 139628871 |
| Molecular Formula | C8H2ClF6NO |
| Molecular Weight | 277.55 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 1-[6-chloro-4-(trifluoromethyl)-3-pyridinyl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cnc(Cl)cc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H2ClF6NO/c9-5-1-4(7(10,11)12)3(2-16-5)6(17)8(13,14)15/h1-2H |
| InChIKey | RPMDHDXSCKCLHD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|