C12H11Cl2N3O3 — CID 139629140
1,3-dichloro-5-(2,4,6-trimethylphenyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 139629140) has the molecular formula C12H11Cl2N3O3 and a molecular weight of 316.14 g/mol. Its IUPAC name is 1,3-dichloro-5-(2,4,6-trimethylphenyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-dichloro-5-(2,4,6-trimethylphenyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139629140 |
| Molecular Formula | C12H11Cl2N3O3 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 1,3-dichloro-5-(2,4,6-trimethylphenyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cc1cc(C)c(-n2c(=O)n(Cl)c(=O)n(Cl)c2=O)c(C)c1 |
| InChI | InChI=1S/C12H11Cl2N3O3/c1-6-4-7(2)9(8(3)5-6)15-10(18)16(13)12(20)17(14)11(15)19/h4-5H,1-3H3 |
| InChIKey | JQKHAGABHRMVRK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |