About 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile
4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile (PubChem CID 139630165) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 139630165 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile |
| SMILES | COC1=C(C#N)C=CC(N)(OC)C1 |
| InChI | InChI=1S/C9H12N2O2/c1-12-8-5-9(11,13-2)4-3-7(8)6-10/h3-4H,5,11H2,1-2H3 |
| InChIKey | JEXGHNGFIYQBHG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile (CID 139630165) is 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile is COC1=C(C#N)C=CC(N)(OC)C1.
What is the InChIKey of 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is JEXGHNGFIYQBHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-12-8-5-9(11,13-2)4-3-7(8)6-10/h3-4H,5,11H2,1-2H3.
What are the key properties of 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile?
4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 180.21 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,4-dimethoxycyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 139630165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).