C20H28N2O5 — CID 139630397
2-acetyl-N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-(4-methoxyphenyl)ethyl]-N-methyl-3-oxobutanamide (PubChem CID 139630397) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-acetyl-N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-(4-methoxyphenyl)ethyl]-N-methyl-3-oxobutanamide.
| Compound Name | 2-acetyl-N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-(4-methoxyphenyl)ethyl]-N-methyl-3-oxobutanamide |
|---|---|
| PubChem CID | 139630397 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-acetyl-N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-(4-methoxyphenyl)ethyl]-N-methyl-3-oxobutanamide |
| SMILES | COc1ccc([C@@H](CN2CC[C@H](O)C2)N(C)C(=O)C(C(C)=O)C(C)=O)cc1 |
| InChI | InChI=1S/C20H28N2O5/c1-13(23)19(14(2)24)20(26)21(3)18(12-22-10-9-16(25)11-22)15-5-7-17(27-4)8-6-15/h5-8,16,18-19,25H,9-12H2,1-4H3/t16-,18+/m0/s1 |
| InChIKey | XACVPKWQHYYIBG-FUHWJXTLSA-N |
| XLogP | 1.06 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|