C24H30N2 — CID 139631031
6-[4-(4-hexylcyclohexyl)phenyl]pyridine-3-carbonitrile (PubChem CID 139631031) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 6-[4-(4-hexylcyclohexyl)phenyl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(4-hexylcyclohexyl)phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139631031 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 6-[4-(4-hexylcyclohexyl)phenyl]pyridine-3-carbonitrile |
| SMILES | CCCCCCC1CCC(c2ccc(-c3ccc(C#N)cn3)cc2)CC1 |
| InChI | InChI=1S/C24H30N2/c1-2-3-4-5-6-19-7-10-21(11-8-19)22-12-14-23(15-13-22)24-16-9-20(17-25)18-26-24/h9,12-16,18-19,21H,2-8,10-11H2,1H3 |
| InChIKey | VOQWQAPXORZGJS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|