About 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one
3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one (PubChem CID 139631281) has the molecular formula C21H31NO2S
and a molecular weight of 361.55 g/mol. Its IUPAC name is 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one |
| PubChem CID | 139631281 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one |
| SMILES | C/C(=C\c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)CN1CSCC1=O |
| InChI | InChI=1S/C21H31NO2S/c1-14(11-22-13-25-12-18(22)23)8-15-9-16(20(2,3)4)19(24)17(10-15)21(5,6)7/h8-10,24H,11-13H2,1-7H3/b14-8+ |
| InChIKey | URRLSIMBTHTFSI-RIYZIHGNSA-N |
| XLogP | 4.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one?
The IUPAC name of 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one (CID 139631281) is 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one is C/C(=C\c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)CN1CSCC1=O.
What is the InChIKey of 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one?
The InChIKey is URRLSIMBTHTFSI-RIYZIHGNSA-N. The full InChI is InChI=1S/C21H31NO2S/c1-14(11-22-13-25-12-18(22)23)8-15-9-16(20(2,3)4)19(24)17(10-15)21(5,6)7/h8-10,24H,11-13H2,1-7H3/b14-8+.
What are the key properties of 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one?
3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one has a molecular weight of 361.55 g/mol, XLogP of 4.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-methylprop-2-enyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 139631281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).