C8H14F3NO3 — CID 139631475
N-(1,1,1-trifluoro-2,2-dihydroxy-4-methylpentan-3-yl)acetamide (PubChem CID 139631475) has the molecular formula C8H14F3NO3 and a molecular weight of 229.20 g/mol. Its IUPAC name is N-(1,1,1-trifluoro-2,2-dihydroxy-4-methylpentan-3-yl)acetamide.
| Compound Name | N-(1,1,1-trifluoro-2,2-dihydroxy-4-methylpentan-3-yl)acetamide |
|---|---|
| PubChem CID | 139631475 |
| Molecular Formula | C8H14F3NO3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(1,1,1-trifluoro-2,2-dihydroxy-4-methylpentan-3-yl)acetamide |
| SMILES | CC(=O)NC(C(C)C)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO3/c1-4(2)6(12-5(3)13)7(14,15)8(9,10)11/h4,6,14-15H,1-3H3,(H,12,13) |
| InChIKey | CQMUDDFKHDNFSF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|