C6H8F3N3O3 — CID 139631705
N,N-diacetamido-2,2,2-trifluoroacetamide (PubChem CID 139631705) has the molecular formula C6H8F3N3O3 and a molecular weight of 227.14 g/mol. Its IUPAC name is N,N-diacetamido-2,2,2-trifluoroacetamide.
| Compound Name | N,N-diacetamido-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 139631705 |
| Molecular Formula | C6H8F3N3O3 |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | N,N-diacetamido-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)NN(NC(C)=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3O3/c1-3(13)10-12(11-4(2)14)5(15)6(7,8)9/h1-2H3,(H,10,13)(H,11,14) |
| InChIKey | ZWQJAKRKQZIWRY-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|