C15H16N2O7 — CID 139632285
benzyl (4S)-3-amino-4-(2-hydroxypropanoyloxy)-2,5-dioxopyrrolidine-1-carboxylate (PubChem CID 139632285) has the molecular formula C15H16N2O7 and a molecular weight of 336.30 g/mol. Its IUPAC name is benzyl (4S)-3-amino-4-(2-hydroxypropanoyloxy)-2,5-dioxopyrrolidine-1-carboxylate.
| Compound Name | benzyl (4S)-3-amino-4-(2-hydroxypropanoyloxy)-2,5-dioxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139632285 |
| Molecular Formula | C15H16N2O7 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | benzyl (4S)-3-amino-4-(2-hydroxypropanoyloxy)-2,5-dioxopyrrolidine-1-carboxylate |
| SMILES | CC(O)C(=O)O[C@@H]1C(=O)N(C(=O)OCc2ccccc2)C(=O)C1N |
| InChI | InChI=1S/C15H16N2O7/c1-8(18)14(21)24-11-10(16)12(19)17(13(11)20)15(22)23-7-9-5-3-2-4-6-9/h2-6,8,10-11,18H,7,16H2,1H3/t8?,10?,11-/m0/s1 |
| InChIKey | PSCDYGAVLGUVAE-RFBVYIQQSA-N |
| XLogP | -0.69 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|