C16H18N4O5S2 — CID 139633382
2,2-dimethylpropanoyl (6R)-7-amino-8-oxo-3-[(Z)-2-(thiadiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboperoxoate (PubChem CID 139633382) has the molecular formula C16H18N4O5S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl (6R)-7-amino-8-oxo-3-[(Z)-2-(thiadiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboperoxoate.
| Compound Name | 2,2-dimethylpropanoyl (6R)-7-amino-8-oxo-3-[(Z)-2-(thiadiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboperoxoate |
|---|---|
| PubChem CID | 139633382 |
| Molecular Formula | C16H18N4O5S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2,2-dimethylpropanoyl (6R)-7-amino-8-oxo-3-[(Z)-2-(thiadiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboperoxoate |
| SMILES | CC(C)(C)C(=O)OOC(=O)C1=C(/C=C\c2csnn2)CS[C@@H]2C(N)C(=O)N12 |
| InChI | InChI=1S/C16H18N4O5S2/c1-16(2,3)15(23)25-24-14(22)11-8(4-5-9-7-27-19-18-9)6-26-13-10(17)12(21)20(11)13/h4-5,7,10,13H,6,17H2,1-3H3/b5-4-/t10?,13-/m1/s1 |
| InChIKey | NQXLKOWMSSOHJX-UTIFESJRSA-N |
| XLogP | 1.10 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|